N-[4-(4-methylphenyl)-5-phenyl-1,3-thiazol-2-yl]acetamide
Chemical Structure Depiction of
N-[4-(4-methylphenyl)-5-phenyl-1,3-thiazol-2-yl]acetamide
N-[4-(4-methylphenyl)-5-phenyl-1,3-thiazol-2-yl]acetamide
Compound characteristics
| Compound ID: | 0485-0002 |
| Compound Name: | N-[4-(4-methylphenyl)-5-phenyl-1,3-thiazol-2-yl]acetamide |
| Molecular Weight: | 308.4 |
| Molecular Formula: | C18 H16 N2 O S |
| Smiles: | CC(Nc1nc(c2ccc(C)cc2)c(c2ccccc2)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7425 |
| logD: | 4.7425 |
| logSw: | -4.5743 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.774 |
| InChI Key: | HLYTWVWJTABNSY-UHFFFAOYSA-N |