4-chloro-N-[4-(4-methylphenyl)-5-phenyl-1,3-thiazol-2-yl]benzamide
Chemical Structure Depiction of
4-chloro-N-[4-(4-methylphenyl)-5-phenyl-1,3-thiazol-2-yl]benzamide
4-chloro-N-[4-(4-methylphenyl)-5-phenyl-1,3-thiazol-2-yl]benzamide
Compound characteristics
| Compound ID: | 0485-0011 |
| Compound Name: | 4-chloro-N-[4-(4-methylphenyl)-5-phenyl-1,3-thiazol-2-yl]benzamide |
| Molecular Weight: | 404.92 |
| Molecular Formula: | C23 H17 Cl N2 O S |
| Smiles: | Cc1ccc(cc1)c1c(c2ccccc2)sc(NC(c2ccc(cc2)[Cl])=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.8504 |
| logD: | 6.8502 |
| logSw: | -6.4144 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.603 |
| InChI Key: | SDJLSPVEYMJEHB-UHFFFAOYSA-N |