N,N-dimethyl-2-[(5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethan-1-amine
Chemical Structure Depiction of
N,N-dimethyl-2-[(5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethan-1-amine
N,N-dimethyl-2-[(5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethan-1-amine
Compound characteristics
| Compound ID: | 0488-0124 |
| Compound Name: | N,N-dimethyl-2-[(5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethan-1-amine |
| Molecular Weight: | 273.36 |
| Molecular Formula: | C13 H15 N5 S |
| Smiles: | CN(C)CCSc1nc2c(c3ccccc3[nH]2)nn1 |
| Stereo: | ACHIRAL |
| logP: | 1.3874 |
| logD: | -0.3489 |
| logSw: | -1.8847 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.672 |
| InChI Key: | NQZVROLVIDEQLV-UHFFFAOYSA-N |