N-(1-acetyl-3-oxo-2,3-dihydro-1H-indol-2-yl)thiourea
Chemical Structure Depiction of
N-(1-acetyl-3-oxo-2,3-dihydro-1H-indol-2-yl)thiourea
N-(1-acetyl-3-oxo-2,3-dihydro-1H-indol-2-yl)thiourea
Compound characteristics
| Compound ID: | 0488-0149 |
| Compound Name: | N-(1-acetyl-3-oxo-2,3-dihydro-1H-indol-2-yl)thiourea |
| Molecular Weight: | 249.29 |
| Molecular Formula: | C11 H11 N3 O2 S |
| Smiles: | CC(N1C(C(c2ccccc12)=O)NC(N)=S)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.1082 |
| logD: | 0.1082 |
| logSw: | -2.2269 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 58.359 |
| InChI Key: | BAYGZCXMYVTCSA-JTQLQIEISA-N |