2-chloro-4-nitro-N-(1-phenylethyl)benzamide
Chemical Structure Depiction of
2-chloro-4-nitro-N-(1-phenylethyl)benzamide
2-chloro-4-nitro-N-(1-phenylethyl)benzamide
Compound characteristics
| Compound ID: | 0490-5729 |
| Compound Name: | 2-chloro-4-nitro-N-(1-phenylethyl)benzamide |
| Molecular Weight: | 304.73 |
| Molecular Formula: | C15 H13 Cl N2 O3 |
| Smiles: | CC(c1ccccc1)NC(c1ccc(cc1[Cl])[N+]([O-])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7306 |
| logD: | 3.7303 |
| logSw: | -4.2956 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.196 |
| InChI Key: | FWMMIDGETIMDPY-JTQLQIEISA-N |