2-(1,3-benzothiazol-2-yl)-4-({[4-(octyloxy)phenyl]methylidene}amino)phenol
Chemical Structure Depiction of
2-(1,3-benzothiazol-2-yl)-4-({[4-(octyloxy)phenyl]methylidene}amino)phenol
2-(1,3-benzothiazol-2-yl)-4-({[4-(octyloxy)phenyl]methylidene}amino)phenol
Compound characteristics
| Compound ID: | 0508-1959 |
| Compound Name: | 2-(1,3-benzothiazol-2-yl)-4-({[4-(octyloxy)phenyl]methylidene}amino)phenol |
| Molecular Weight: | 458.62 |
| Molecular Formula: | C28 H30 N2 O2 S |
| Smiles: | CCCCCCCCOc1ccc(/C=N/c2ccc(c(c2)c2nc3ccccc3s2)O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 8.9503 |
| logD: | 8.9485 |
| logSw: | -5.6243 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.781 |
| InChI Key: | RWSZBRRUKIKQOT-UHFFFAOYSA-N |