N~4~,N~4'~-bis(4-methylphenyl)[2,2'-biquinoline]-4,4'-dicarboxamide
Chemical Structure Depiction of
N~4~,N~4'~-bis(4-methylphenyl)[2,2'-biquinoline]-4,4'-dicarboxamide
N~4~,N~4'~-bis(4-methylphenyl)[2,2'-biquinoline]-4,4'-dicarboxamide
Compound characteristics
| Compound ID: | 0564-0104 |
| Compound Name: | N~4~,N~4'~-bis(4-methylphenyl)[2,2'-biquinoline]-4,4'-dicarboxamide |
| Molecular Weight: | 522.61 |
| Molecular Formula: | C34 H26 N4 O2 |
| Smiles: | Cc1ccc(cc1)NC(c1cc(c2cc(C(Nc3ccc(C)cc3)=O)c3ccccc3n2)nc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 7.8615 |
| logD: | 7.8615 |
| logSw: | -5.9344 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.811 |
| InChI Key: | UAHZEVXHKRPJKD-UHFFFAOYSA-N |