N'-[(4-hydroxy-3-methoxyphenyl)methylidene]adamantane-1-carbohydrazide
Chemical Structure Depiction of
N'-[(4-hydroxy-3-methoxyphenyl)methylidene]adamantane-1-carbohydrazide
N'-[(4-hydroxy-3-methoxyphenyl)methylidene]adamantane-1-carbohydrazide
Compound characteristics
| Compound ID: | 0570-0113 |
| Compound Name: | N'-[(4-hydroxy-3-methoxyphenyl)methylidene]adamantane-1-carbohydrazide |
| Molecular Weight: | 328.41 |
| Molecular Formula: | C19 H24 N2 O3 |
| Smiles: | COc1cc(/C=N/NC(C23CC4CC(CC(C4)C3)C2)=O)ccc1O |
| Stereo: | ACHIRAL |
| logP: | 3.9782 |
| logD: | 3.9752 |
| logSw: | -3.7706 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.766 |
| InChI Key: | QQLDUAREXRIMNR-UHFFFAOYSA-N |