2-[(4-phenylpiperazin-1-yl)methyl]-4-(2,2,3,3-tetramethylbutyl)phenol
Chemical Structure Depiction of
2-[(4-phenylpiperazin-1-yl)methyl]-4-(2,2,3,3-tetramethylbutyl)phenol
2-[(4-phenylpiperazin-1-yl)methyl]-4-(2,2,3,3-tetramethylbutyl)phenol
Compound characteristics
| Compound ID: | 0572-0011 |
| Compound Name: | 2-[(4-phenylpiperazin-1-yl)methyl]-4-(2,2,3,3-tetramethylbutyl)phenol |
| Molecular Weight: | 380.57 |
| Molecular Formula: | C25 H36 N2 O |
| Smiles: | CC(C)(C)C(C)(C)Cc1ccc(c(CN2CCN(CC2)c2ccccc2)c1)O |
| Stereo: | ACHIRAL |
| logP: | 5.6645 |
| logD: | 5.2611 |
| logSw: | -5.3564 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.7794 |
| InChI Key: | WZZAMHDJKBXHSW-UHFFFAOYSA-N |