2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazine-1-carboximidamide
Chemical Structure Depiction of
2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazine-1-carboximidamide
2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazine-1-carboximidamide
Compound characteristics
| Compound ID: | 0589-0006 |
| Compound Name: | 2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazine-1-carboximidamide |
| Molecular Weight: | 252.27 |
| Molecular Formula: | C11 H16 N4 O3 |
| Smiles: | COc1cc(/C=N/NC(N)=N)cc(c1OC)OC |
| Stereo: | ACHIRAL |
| logP: | 0.4101 |
| logD: | -6.524 |
| logSw: | -1.4091 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 84.278 |
| InChI Key: | LDLMSHUTQZWFDD-UHFFFAOYSA-N |