N'-[(2-chloroquinolin-3-yl)methylidene]-4-nitrobenzohydrazide
Chemical Structure Depiction of
N'-[(2-chloroquinolin-3-yl)methylidene]-4-nitrobenzohydrazide
N'-[(2-chloroquinolin-3-yl)methylidene]-4-nitrobenzohydrazide
Compound characteristics
| Compound ID: | 0590-0407 |
| Compound Name: | N'-[(2-chloroquinolin-3-yl)methylidene]-4-nitrobenzohydrazide |
| Molecular Weight: | 354.75 |
| Molecular Formula: | C17 H11 Cl N4 O3 |
| Smiles: | C(/c1cc2ccccc2nc1[Cl])=N/NC(c1ccc(cc1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0245 |
| logD: | 3.7301 |
| logSw: | -4.4789 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.904 |
| InChI Key: | XUFATMOLAGTNKU-UHFFFAOYSA-N |