N-(2-methyl-5-nitrophenyl)thiophene-2-carboxamide
Chemical Structure Depiction of
N-(2-methyl-5-nitrophenyl)thiophene-2-carboxamide
N-(2-methyl-5-nitrophenyl)thiophene-2-carboxamide
Compound characteristics
| Compound ID: | 0591-5347 |
| Compound Name: | N-(2-methyl-5-nitrophenyl)thiophene-2-carboxamide |
| Molecular Weight: | 262.28 |
| Molecular Formula: | C12 H10 N2 O3 S |
| Smiles: | Cc1ccc(cc1NC(c1cccs1)=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.9275 |
| logD: | 2.9214 |
| logSw: | -3.3699 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.032 |
| InChI Key: | UAWSKUQDCFKEEM-UHFFFAOYSA-N |