5-tert-butyl-4-phenyl-1,3-thiazol-2-amine
Chemical Structure Depiction of
5-tert-butyl-4-phenyl-1,3-thiazol-2-amine
5-tert-butyl-4-phenyl-1,3-thiazol-2-amine
Compound characteristics
| Compound ID: | 0671-0159 |
| Compound Name: | 5-tert-butyl-4-phenyl-1,3-thiazol-2-amine |
| Molecular Weight: | 232.34 |
| Molecular Formula: | C13 H16 N2 S |
| Smiles: | CC(C)(C)c1c(c2ccccc2)nc(N)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.8424 |
| logD: | 3.8286 |
| logSw: | -4.0712 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 31.5407 |
| InChI Key: | CNMGPWGMAPXPOX-UHFFFAOYSA-N |