2,2'-[ethane-1,2-diylbis(oxy)]dibenzaldehyde
Chemical Structure Depiction of
2,2'-[ethane-1,2-diylbis(oxy)]dibenzaldehyde
2,2'-[ethane-1,2-diylbis(oxy)]dibenzaldehyde
Compound characteristics
| Compound ID: | 0682-0034 |
| Compound Name: | 2,2'-[ethane-1,2-diylbis(oxy)]dibenzaldehyde |
| Molecular Weight: | 270.28 |
| Molecular Formula: | C16 H14 O4 |
| Smiles: | [H]C(c1ccccc1OCCOc1ccccc1C([H])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1583 |
| logD: | 3.1583 |
| logSw: | -2.9606 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.294 |
| InChI Key: | YXPZEGOFLHNCCI-UHFFFAOYSA-N |