3-chloro-N-[2,2,2-trichloro-1-(2-methoxyanilino)ethyl]benzamide
Chemical Structure Depiction of
3-chloro-N-[2,2,2-trichloro-1-(2-methoxyanilino)ethyl]benzamide
3-chloro-N-[2,2,2-trichloro-1-(2-methoxyanilino)ethyl]benzamide
Compound characteristics
| Compound ID: | 0687-0669 |
| Compound Name: | 3-chloro-N-[2,2,2-trichloro-1-(2-methoxyanilino)ethyl]benzamide |
| Molecular Weight: | 408.11 |
| Molecular Formula: | C16 H14 Cl4 N2 O2 |
| Smiles: | COc1ccccc1NC(C([Cl])([Cl])[Cl])NC(c1cccc(c1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5527 |
| logD: | 4.103 |
| logSw: | -4.7378 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 40.382 |
| InChI Key: | QSJUOVQOLOLZJQ-OAHLLOKOSA-N |