[4-(heptyloxy)phenyl]methyl methyl pyridine-2,6-dicarboxylate
Chemical Structure Depiction of
[4-(heptyloxy)phenyl]methyl methyl pyridine-2,6-dicarboxylate
[4-(heptyloxy)phenyl]methyl methyl pyridine-2,6-dicarboxylate
Compound characteristics
| Compound ID: | 0703-6358 |
| Compound Name: | [4-(heptyloxy)phenyl]methyl methyl pyridine-2,6-dicarboxylate |
| Molecular Weight: | 385.46 |
| Molecular Formula: | C22 H27 N O5 |
| Smiles: | CCCCCCCOc1ccc(COC(c2cccc(C(=O)OC)n2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.4275 |
| logD: | 5.4275 |
| logSw: | -5.3015 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 58.303 |
| InChI Key: | XPGZICFMPYBVFD-UHFFFAOYSA-N |