4-chloro-N-cyclohexylbenzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-cyclohexylbenzene-1-sulfonamide
4-chloro-N-cyclohexylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | 0711-0094 |
| Compound Name: | 4-chloro-N-cyclohexylbenzene-1-sulfonamide |
| Molecular Weight: | 273.78 |
| Molecular Formula: | C12 H16 Cl N O2 S |
| Smiles: | C1CCC(CC1)NS(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8795 |
| logD: | 3.8795 |
| logSw: | -4.2655 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.935 |
| InChI Key: | LXJLMDHHUXKUJA-UHFFFAOYSA-N |