N-methyl-N-(4-nitrophenyl)acetamide
Chemical Structure Depiction of
N-methyl-N-(4-nitrophenyl)acetamide
N-methyl-N-(4-nitrophenyl)acetamide
Compound characteristics
| Compound ID: | 0768-0016 |
| Compound Name: | N-methyl-N-(4-nitrophenyl)acetamide |
| Molecular Weight: | 194.19 |
| Molecular Formula: | C9 H10 N2 O3 |
| Smiles: | CC(N(C)c1ccc(cc1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.8491 |
| logD: | 0.8491 |
| logSw: | -1.5277 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.728 |
| InChI Key: | DKZFYTVXALXRSH-UHFFFAOYSA-N |