4-(hexyloxy)phenyl 4-(5-ethylpyridin-2-yl)benzoate
Chemical Structure Depiction of
4-(hexyloxy)phenyl 4-(5-ethylpyridin-2-yl)benzoate
4-(hexyloxy)phenyl 4-(5-ethylpyridin-2-yl)benzoate
Compound characteristics
| Compound ID: | 0777-4172 |
| Compound Name: | 4-(hexyloxy)phenyl 4-(5-ethylpyridin-2-yl)benzoate |
| Molecular Weight: | 403.52 |
| Molecular Formula: | C26 H29 N O3 |
| Smiles: | CCCCCCOc1ccc(cc1)OC(c1ccc(cc1)c1ccc(CC)cn1)=O |
| Stereo: | ACHIRAL |
| logP: | 7.4371 |
| logD: | 7.4218 |
| logSw: | -5.6768 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.9 |
| InChI Key: | AODJGQVMLQKAQM-UHFFFAOYSA-N |