4-bromophenyl 4-(5-ethylpyridin-2-yl)benzoate
Chemical Structure Depiction of
4-bromophenyl 4-(5-ethylpyridin-2-yl)benzoate
4-bromophenyl 4-(5-ethylpyridin-2-yl)benzoate
Compound characteristics
| Compound ID: | 0777-4186 |
| Compound Name: | 4-bromophenyl 4-(5-ethylpyridin-2-yl)benzoate |
| Molecular Weight: | 382.26 |
| Molecular Formula: | C20 H16 Br N O2 |
| Smiles: | CCc1ccc(c2ccc(cc2)C(=O)Oc2ccc(cc2)[Br])nc1 |
| Stereo: | ACHIRAL |
| logP: | 5.7926 |
| logD: | 5.7773 |
| logSw: | -5.4373 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.4821 |
| InChI Key: | JQRCXXNICYWLTN-UHFFFAOYSA-N |