N-{2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl}thiophene-2-carboxamide
Chemical Structure Depiction of
N-{2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl}thiophene-2-carboxamide
N-{2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | 0800-0568 |
| Compound Name: | N-{2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl}thiophene-2-carboxamide |
| Molecular Weight: | 440.52 |
| Molecular Formula: | C26 H20 N2 O3 S |
| Smiles: | Cc1ccc(c(c1)C(c1ccccc1)=O)NC(c1ccccc1NC(c1cccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2214 |
| logD: | 5.2188 |
| logSw: | -5.0678 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.511 |
| InChI Key: | AAMGLAPYIYMMEX-UHFFFAOYSA-N |