1-({[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]imino}methyl)naphthalen-2-ol
Chemical Structure Depiction of
1-({[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]imino}methyl)naphthalen-2-ol
1-({[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]imino}methyl)naphthalen-2-ol
Compound characteristics
| Compound ID: | 0808-0108 |
| Compound Name: | 1-({[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]imino}methyl)naphthalen-2-ol |
| Molecular Weight: | 408.46 |
| Molecular Formula: | C26 H20 N2 O3 |
| Smiles: | CCOc1ccc(cc1)c1nc2cc(ccc2o1)/N=C/c1c(ccc2ccccc12)O |
| Stereo: | ACHIRAL |
| logP: | 6.0418 |
| logD: | 5.9971 |
| logSw: | -6.4586 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.576 |
| InChI Key: | BHXKWIXRPGSVCW-UHFFFAOYSA-N |