2,6-dibromo-4-chlorophenol
Chemical Structure Depiction of
2,6-dibromo-4-chlorophenol
2,6-dibromo-4-chlorophenol
Compound characteristics
| Compound ID: | 0809-0025 |
| Compound Name: | 2,6-dibromo-4-chlorophenol |
| Molecular Weight: | 286.35 |
| Molecular Formula: | C6 H3 Br2 Cl O |
| Smiles: | c1c(cc(c(c1[Br])O)[Br])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.6064 |
| logD: | 2.9772 |
| logSw: | -3.1851 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 15.7175 |
| InChI Key: | WYZQOLPTPZDTIF-UHFFFAOYSA-N |