4'-[(E)-(2-{[3-(4-methylphenyl)adamantan-1-yl]carbamoyl}hydrazinylidene)methyl][1,1'-biphenyl]-4-yl acetate
Chemical Structure Depiction of
4'-[(E)-(2-{[3-(4-methylphenyl)adamantan-1-yl]carbamoyl}hydrazinylidene)methyl][1,1'-biphenyl]-4-yl acetate
4'-[(E)-(2-{[3-(4-methylphenyl)adamantan-1-yl]carbamoyl}hydrazinylidene)methyl][1,1'-biphenyl]-4-yl acetate
Compound characteristics
| Compound ID: | 0832-2757 |
| Compound Name: | 4'-[(E)-(2-{[3-(4-methylphenyl)adamantan-1-yl]carbamoyl}hydrazinylidene)methyl][1,1'-biphenyl]-4-yl acetate |
| Molecular Weight: | 521.66 |
| Molecular Formula: | C33 H35 N3 O3 |
| Smiles: | CC(=O)Oc1ccc(cc1)c1ccc(/C=N/NC(NC23CC4CC(CC(C4)(C3)c3ccc(C)cc3)C2)=O)cc1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 7.6408 |
| logD: | 7.6407 |
| logSw: | -5.8979 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.992 |
| InChI Key: | ONQDCKYXKQMHNO-UHFFFAOYSA-N |