N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylidene]-3-(4-methylphenyl)adamantane-1-carbohydrazide
Chemical Structure Depiction of
N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylidene]-3-(4-methylphenyl)adamantane-1-carbohydrazide
N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylidene]-3-(4-methylphenyl)adamantane-1-carbohydrazide
Compound characteristics
| Compound ID: | 0832-2781 |
| Compound Name: | N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylidene]-3-(4-methylphenyl)adamantane-1-carbohydrazide |
| Molecular Weight: | 418.54 |
| Molecular Formula: | C26 H30 N2 O3 |
| Smiles: | Cc1ccc(cc1)C12CC3CC(CC(C3)(C2)C(N/N=C/c2ccc(c(c2)OC)O)=O)C1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.0491 |
| logD: | 6.0349 |
| logSw: | -5.3099 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.494 |
| InChI Key: | UIPLLABJHFBIQN-JFLMPSFJSA-N |