N'-{(E)-[4-(diethylamino)phenyl]methylidene}-3-(4-methylphenyl)adamantane-1-carbohydrazide
Chemical Structure Depiction of
N'-{(E)-[4-(diethylamino)phenyl]methylidene}-3-(4-methylphenyl)adamantane-1-carbohydrazide
N'-{(E)-[4-(diethylamino)phenyl]methylidene}-3-(4-methylphenyl)adamantane-1-carbohydrazide
Compound characteristics
| Compound ID: | 0832-2783 |
| Compound Name: | N'-{(E)-[4-(diethylamino)phenyl]methylidene}-3-(4-methylphenyl)adamantane-1-carbohydrazide |
| Molecular Weight: | 443.63 |
| Molecular Formula: | C29 H37 N3 O |
| Smiles: | CCN(CC)c1ccc(/C=N/NC(C23CC4CC(C2)CC(C4)(C3)c2ccc(C)cc2)=O)cc1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 7.5109 |
| logD: | 7.4801 |
| logSw: | -5.788 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.052 |
| InChI Key: | YJBYDFLTZLVTOZ-UHFFFAOYSA-N |