2-(4-bromophenyl)-2-oxoethyl 3-bromobenzoate
Chemical Structure Depiction of
2-(4-bromophenyl)-2-oxoethyl 3-bromobenzoate
2-(4-bromophenyl)-2-oxoethyl 3-bromobenzoate
Compound characteristics
| Compound ID: | 0848-0235 |
| Compound Name: | 2-(4-bromophenyl)-2-oxoethyl 3-bromobenzoate |
| Molecular Weight: | 398.05 |
| Molecular Formula: | C15 H10 Br2 O3 |
| Smiles: | C(C(c1ccc(cc1)[Br])=O)OC(c1cccc(c1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.8411 |
| logD: | 4.8411 |
| logSw: | -5.0819 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 34.343 |
| InChI Key: | PEUKGUWJXCPWPV-UHFFFAOYSA-N |