N-(4-tert-butyl-2-nitrophenyl)benzamide
Chemical Structure Depiction of
N-(4-tert-butyl-2-nitrophenyl)benzamide
N-(4-tert-butyl-2-nitrophenyl)benzamide
Compound characteristics
| Compound ID: | 0865-0101 |
| Compound Name: | N-(4-tert-butyl-2-nitrophenyl)benzamide |
| Molecular Weight: | 298.34 |
| Molecular Formula: | C17 H18 N2 O3 |
| Smiles: | CC(C)(C)c1ccc(c(c1)[N+]([O-])=O)NC(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5461 |
| logD: | 4.1556 |
| logSw: | -4.4073 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.712 |
| InChI Key: | CSKHWXZLDXSYSP-UHFFFAOYSA-N |