N'~1~,N'~5~-bis[(4-nitrophenyl)methylidene]pentanedihydrazide
Chemical Structure Depiction of
N'~1~,N'~5~-bis[(4-nitrophenyl)methylidene]pentanedihydrazide
N'~1~,N'~5~-bis[(4-nitrophenyl)methylidene]pentanedihydrazide
Compound characteristics
| Compound ID: | 0896-8774 |
| Compound Name: | N'~1~,N'~5~-bis[(4-nitrophenyl)methylidene]pentanedihydrazide |
| Molecular Weight: | 426.39 |
| Molecular Formula: | C19 H18 N6 O6 |
| Smiles: | C(CC(N/N=C/c1ccc(cc1)[N+]([O-])=O)=O)CC(N/N=C/c1ccc(cc1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0627 |
| logD: | 2.0623 |
| logSw: | -2.6786 |
| Hydrogen bond acceptors count: | 14 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 137.478 |
| InChI Key: | AAXACTHSNRWYEX-UHFFFAOYSA-N |