4-(diethylsulfamoyl)-N-{4-[3-(4-methylphenyl)adamantan-1-yl]-1,3-thiazol-2-yl}benzamide
Chemical Structure Depiction of
4-(diethylsulfamoyl)-N-{4-[3-(4-methylphenyl)adamantan-1-yl]-1,3-thiazol-2-yl}benzamide
4-(diethylsulfamoyl)-N-{4-[3-(4-methylphenyl)adamantan-1-yl]-1,3-thiazol-2-yl}benzamide
Compound characteristics
| Compound ID: | 0906-3095 |
| Compound Name: | 4-(diethylsulfamoyl)-N-{4-[3-(4-methylphenyl)adamantan-1-yl]-1,3-thiazol-2-yl}benzamide |
| Molecular Weight: | 563.78 |
| Molecular Formula: | C31 H37 N3 O3 S2 |
| Smiles: | CCN(CC)S(c1ccc(cc1)C(Nc1nc(cs1)C12CC3CC(CC(C3)(C2)c2ccc(C)cc2)C1)=O)(=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 7.9487 |
| logD: | 7.5456 |
| logSw: | -5.7444 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.963 |
| InChI Key: | YBVVTYRTNUHKOF-UHFFFAOYSA-N |