N-[4-bromo-3-(trifluoromethyl)phenyl]-4-fluorobenzamide
Chemical Structure Depiction of
N-[4-bromo-3-(trifluoromethyl)phenyl]-4-fluorobenzamide
N-[4-bromo-3-(trifluoromethyl)phenyl]-4-fluorobenzamide
Compound characteristics
| Compound ID: | 0958-0027 |
| Compound Name: | N-[4-bromo-3-(trifluoromethyl)phenyl]-4-fluorobenzamide |
| Molecular Weight: | 362.12 |
| Molecular Formula: | C14 H8 Br F4 N O |
| Smiles: | c1cc(ccc1C(Nc1ccc(c(c1)C(F)(F)F)[Br])=O)F |
| Stereo: | ACHIRAL |
| logP: | 4.5236 |
| logD: | 3.172 |
| logSw: | -4.521 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.3296 |
| InChI Key: | VQVQNDPMOCIMJV-UHFFFAOYSA-N |