2,4-dichloro-6-({[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]imino}methyl)phenol
Chemical Structure Depiction of
2,4-dichloro-6-({[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]imino}methyl)phenol
2,4-dichloro-6-({[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]imino}methyl)phenol
Compound characteristics
| Compound ID: | 0958-0323 |
| Compound Name: | 2,4-dichloro-6-({[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]imino}methyl)phenol |
| Molecular Weight: | 425.31 |
| Molecular Formula: | C23 H18 Cl2 N2 O2 |
| Smiles: | Cc1cc(C)c2c(c1)nc(c1ccc(C)c(c1)/N=C/c1cc(cc(c1O)[Cl])[Cl])o2 |
| Stereo: | ACHIRAL |
| logP: | 7.3275 |
| logD: | 6.7478 |
| logSw: | -6.1679 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.19 |
| InChI Key: | YPPRBAZKCCDRNP-UHFFFAOYSA-N |