4-methylcyclohexyl 6-methyl-4-(4-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
4-methylcyclohexyl 6-methyl-4-(4-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
4-methylcyclohexyl 6-methyl-4-(4-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | 0982-0120 |
| Compound Name: | 4-methylcyclohexyl 6-methyl-4-(4-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 373.41 |
| Molecular Formula: | C19 H23 N3 O5 |
| Smiles: | CC1CCC(CC1)OC(C1C(c2ccc(cc2)[N+]([O-])=O)NC(NC=1C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.66 |
| logD: | 3.5098 |
| logSw: | -3.8092 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 89.157 |
| InChI Key: | QGIGYFACAMNNDO-FQRFQQLUSA-N |