diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate
Chemical Structure Depiction of
diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate
diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate
Compound characteristics
| Compound ID: | 0DOU-0188 |
| Compound Name: | diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
| Molecular Weight: | 257.31 |
| Molecular Formula: | C11 H15 N O4 S |
| Smiles: | CCOC(c1c(C)c(C(=O)OCC)sc1N)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0766 |
| logD: | 2.0766 |
| logSw: | -1.9002 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.022 |
| InChI Key: | DGVXLHAJVRRLGV-UHFFFAOYSA-N |