N-(2-hydroxyethyl)tricyclo[4.3.1.1~3,8~]undecane-1-carboxamide
Chemical Structure Depiction of
N-(2-hydroxyethyl)tricyclo[4.3.1.1~3,8~]undecane-1-carboxamide
N-(2-hydroxyethyl)tricyclo[4.3.1.1~3,8~]undecane-1-carboxamide
Compound characteristics
| Compound ID: | 0KPI-0111 |
| Compound Name: | N-(2-hydroxyethyl)tricyclo[4.3.1.1~3,8~]undecane-1-carboxamide |
| Molecular Weight: | 237.34 |
| Molecular Formula: | C14 H23 N O2 |
| Smiles: | C1CC2CC3CC1CC(C2)(C3)C(NCCO)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.3971 |
| logD: | 2.3971 |
| logSw: | -2.3368 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.785 |
| InChI Key: | KSAKGTQVACDSDR-UHFFFAOYSA-N |