6-bromo-3-{5-(4-bromophenyl)-1-[(4-methylpiperazin-1-yl)acetyl]-4,5-dihydro-1H-pyrazol-3-yl}-4-phenylquinolin-2(1H)-one
Chemical Structure Depiction of
6-bromo-3-{5-(4-bromophenyl)-1-[(4-methylpiperazin-1-yl)acetyl]-4,5-dihydro-1H-pyrazol-3-yl}-4-phenylquinolin-2(1H)-one
6-bromo-3-{5-(4-bromophenyl)-1-[(4-methylpiperazin-1-yl)acetyl]-4,5-dihydro-1H-pyrazol-3-yl}-4-phenylquinolin-2(1H)-one
Compound characteristics
| Compound ID: | 1000-1366 |
| Compound Name: | 6-bromo-3-{5-(4-bromophenyl)-1-[(4-methylpiperazin-1-yl)acetyl]-4,5-dihydro-1H-pyrazol-3-yl}-4-phenylquinolin-2(1H)-one |
| Molecular Weight: | 663.41 |
| Molecular Formula: | C31 H29 Br2 N5 O2 |
| Smiles: | CN1CCN(CC1)CC(N1C(CC(C2=C(c3ccccc3)c3cc(ccc3NC2=O)[Br])=N1)c1ccc(cc1)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5967 |
| logD: | 4.9279 |
| logSw: | -5.4759 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.674 |
| InChI Key: | DYUQDLLUBTXFML-HHHXNRCGSA-N |