4-bromo-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide
Chemical Structure Depiction of
4-bromo-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide
4-bromo-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | 1003-0024 |
| Compound Name: | 4-bromo-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide |
| Molecular Weight: | 373.27 |
| Molecular Formula: | C17 H13 Br N2 O S |
| Smiles: | Cc1nc(cs1)c1cccc(c1)NC(c1ccc(cc1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 5.2503 |
| logD: | 5.2501 |
| logSw: | -5.1451 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.87 |
| InChI Key: | QUVDHRNSGKMLMJ-UHFFFAOYSA-N |