5-[(2-methoxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(2-methoxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
5-[(2-methoxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 1013-0314 |
| Compound Name: | 5-[(2-methoxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 265.35 |
| Molecular Formula: | C12 H11 N O2 S2 |
| Smiles: | CN1C(/C(=C\c2ccccc2OC)SC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7061 |
| logD: | 2.7061 |
| logSw: | -3.0904 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 24.11 |
| InChI Key: | KVRGMVGOHHPOCN-UHFFFAOYSA-N |