N-[5-(2-{2-[(4-bromophenyl)methylidene]hydrazinyl}-2-oxoethyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide
Chemical Structure Depiction of
N-[5-(2-{2-[(4-bromophenyl)methylidene]hydrazinyl}-2-oxoethyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide
N-[5-(2-{2-[(4-bromophenyl)methylidene]hydrazinyl}-2-oxoethyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide
Compound characteristics
| Compound ID: | 1067-0324 |
| Compound Name: | N-[5-(2-{2-[(4-bromophenyl)methylidene]hydrazinyl}-2-oxoethyl)-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
| Molecular Weight: | 458.33 |
| Molecular Formula: | C19 H16 Br N5 O2 S |
| Smiles: | Cc1cccc(c1)C(Nc1nnc(CC(N/N=C/c2ccc(cc2)[Br])=O)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1327 |
| logD: | 3.3573 |
| logSw: | -4.287 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 82.472 |
| InChI Key: | NKUNBTQMSSWZTQ-UHFFFAOYSA-N |