5-(4-methylanilino)-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
5-(4-methylanilino)-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione
5-(4-methylanilino)-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 1114-0203 |
| Compound Name: | 5-(4-methylanilino)-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 312.39 |
| Molecular Formula: | C17 H16 N2 O2 S |
| Smiles: | Cc1ccc(cc1)NC1C(N(C(=O)S1)c1ccc(C)cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8757 |
| logD: | 3.8757 |
| logSw: | -3.9368 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.384 |
| InChI Key: | HKSDAVZYGBEOEJ-HNNXBMFYSA-N |