1-(4-methoxyphenyl)-N-(quinolin-5-yl)methanimine
Chemical Structure Depiction of
1-(4-methoxyphenyl)-N-(quinolin-5-yl)methanimine
1-(4-methoxyphenyl)-N-(quinolin-5-yl)methanimine
Compound characteristics
| Compound ID: | 1123-0149 |
| Compound Name: | 1-(4-methoxyphenyl)-N-(quinolin-5-yl)methanimine |
| Molecular Weight: | 262.31 |
| Molecular Formula: | C17 H14 N2 O |
| Smiles: | COc1ccc(/C=N/c2cccc3c2cccn3)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.2888 |
| logD: | 3.2887 |
| logSw: | -3.4132 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.9746 |
| InChI Key: | GBVCKGVVBYYNTE-UHFFFAOYSA-N |