N-(3,4-dichlorophenyl)-1-(4-ethoxyphenyl)methanimine
Chemical Structure Depiction of
N-(3,4-dichlorophenyl)-1-(4-ethoxyphenyl)methanimine
N-(3,4-dichlorophenyl)-1-(4-ethoxyphenyl)methanimine
Compound characteristics
| Compound ID: | 1123-0168 |
| Compound Name: | N-(3,4-dichlorophenyl)-1-(4-ethoxyphenyl)methanimine |
| Molecular Weight: | 294.18 |
| Molecular Formula: | C15 H13 Cl2 N O |
| Smiles: | CCOc1ccc(/C=N/c2ccc(c(c2)[Cl])[Cl])cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.8932 |
| logD: | 4.8931 |
| logSw: | -5.0479 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 15.4894 |
| InChI Key: | WSFIOOVAYGHMCZ-UHFFFAOYSA-N |