N,N'-[oxydi(4,1-phenylene)]bis[1-(4-methoxyphenyl)methanimine]
					Chemical Structure Depiction of
N,N'-[oxydi(4,1-phenylene)]bis[1-(4-methoxyphenyl)methanimine]
			N,N'-[oxydi(4,1-phenylene)]bis[1-(4-methoxyphenyl)methanimine]
Compound characteristics
| Compound ID: | 1123-0305 | 
| Compound Name: | N,N'-[oxydi(4,1-phenylene)]bis[1-(4-methoxyphenyl)methanimine] | 
| Molecular Weight: | 436.51 | 
| Molecular Formula: | C28 H24 N2 O3 | 
| Smiles: | COc1ccc(/C=N/c2ccc(cc2)Oc2ccc(cc2)/N=C/c2ccc(cc2)OC)cc1 | 
| Stereo: | ACHIRAL | 
| logP: | 5.8533 | 
| logD: | 5.8532 | 
| logSw: | -5.8219 | 
| Hydrogen bond acceptors count: | 5 | 
| Polar surface area: | 38.329 | 
| InChI Key: | SSNRMSCFXPROTC-UHFFFAOYSA-N | 
 
				 
				