2-[2-(5-bromo-1-methyl-2-oxo-1,2-dihydro-3H-indol-3-ylidene)hydrazinyl]-3-(prop-2-en-1-yl)quinazolin-4(3H)-one
Chemical Structure Depiction of
2-[2-(5-bromo-1-methyl-2-oxo-1,2-dihydro-3H-indol-3-ylidene)hydrazinyl]-3-(prop-2-en-1-yl)quinazolin-4(3H)-one
2-[2-(5-bromo-1-methyl-2-oxo-1,2-dihydro-3H-indol-3-ylidene)hydrazinyl]-3-(prop-2-en-1-yl)quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | 1124-0170 |
| Compound Name: | 2-[2-(5-bromo-1-methyl-2-oxo-1,2-dihydro-3H-indol-3-ylidene)hydrazinyl]-3-(prop-2-en-1-yl)quinazolin-4(3H)-one |
| Molecular Weight: | 438.28 |
| Molecular Formula: | C20 H16 Br N5 O2 |
| Smiles: | CN1C(C(/c2cc(ccc12)[Br])=N/NC1=Nc2ccccc2C(N1CC=C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3657 |
| logD: | 3.1742 |
| logSw: | -3.9044 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.818 |
| InChI Key: | XJUXVFISCGXDKQ-UHFFFAOYSA-N |