6-bromo-N-(4-fluorophenyl)-2-imino-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
6-bromo-N-(4-fluorophenyl)-2-imino-2H-1-benzopyran-3-carboxamide
6-bromo-N-(4-fluorophenyl)-2-imino-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | 1151-0270 |
| Compound Name: | 6-bromo-N-(4-fluorophenyl)-2-imino-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 361.17 |
| Molecular Formula: | C16 H10 Br F N2 O2 |
| Smiles: | C1=C(C(=N)Oc2ccc(cc12)[Br])C(Nc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5064 |
| logD: | 3.4903 |
| logSw: | -3.7952 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.568 |
| InChI Key: | LSRLKXQJZJBMEX-UHFFFAOYSA-N |