diethyl [2-(4-methylphenyl)-5-(morpholin-4-yl)-1,3-oxazol-4-yl]phosphonate
Chemical Structure Depiction of
diethyl [2-(4-methylphenyl)-5-(morpholin-4-yl)-1,3-oxazol-4-yl]phosphonate
diethyl [2-(4-methylphenyl)-5-(morpholin-4-yl)-1,3-oxazol-4-yl]phosphonate
Compound characteristics
| Compound ID: | 1187-0419 |
| Compound Name: | diethyl [2-(4-methylphenyl)-5-(morpholin-4-yl)-1,3-oxazol-4-yl]phosphonate |
| Molecular Weight: | 380.38 |
| Molecular Formula: | C18 H25 N2 O5 P |
| Smiles: | CCOP(c1c(N2CCOCC2)oc(c2ccc(C)cc2)n1)(=O)OCC |
| Stereo: | ACHIRAL |
| logP: | 2.7016 |
| logD: | 2.7016 |
| logSw: | -2.691 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 60.335 |
| InChI Key: | BUEOWLTXHALQIB-UHFFFAOYSA-N |