5-(benzylamino)-2-(4-methylphenyl)-1,3-oxazole-4-carbonitrile
Chemical Structure Depiction of
5-(benzylamino)-2-(4-methylphenyl)-1,3-oxazole-4-carbonitrile
5-(benzylamino)-2-(4-methylphenyl)-1,3-oxazole-4-carbonitrile
Compound characteristics
| Compound ID: | 1187-0657 |
| Compound Name: | 5-(benzylamino)-2-(4-methylphenyl)-1,3-oxazole-4-carbonitrile |
| Molecular Weight: | 289.33 |
| Molecular Formula: | C18 H15 N3 O |
| Smiles: | Cc1ccc(cc1)c1nc(C#N)c(NCc2ccccc2)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.7754 |
| logD: | 3.7754 |
| logSw: | -4.0091 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.278 |
| InChI Key: | JAIJGFBQCIBINX-UHFFFAOYSA-N |