5,5'-(1,4-phenylene)bis[1-(4-methylphenyl)-1H-tetrazole]
Chemical Structure Depiction of
5,5'-(1,4-phenylene)bis[1-(4-methylphenyl)-1H-tetrazole]
5,5'-(1,4-phenylene)bis[1-(4-methylphenyl)-1H-tetrazole]
Compound characteristics
| Compound ID: | 1214-0005 |
| Compound Name: | 5,5'-(1,4-phenylene)bis[1-(4-methylphenyl)-1H-tetrazole] |
| Molecular Weight: | 394.44 |
| Molecular Formula: | C22 H18 N8 |
| Smiles: | Cc1ccc(cc1)n1c(c2ccc(cc2)c2nnnn2c2ccc(C)cc2)nnn1 |
| Stereo: | ACHIRAL |
| logP: | 4.9056 |
| logD: | 4.9056 |
| logSw: | -4.6683 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 78.376 |
| InChI Key: | MBPGPAHWPJVRAL-UHFFFAOYSA-N |