4-methoxy-N'-[(3-nitrophenyl)methylidene]benzohydrazide
Chemical Structure Depiction of
4-methoxy-N'-[(3-nitrophenyl)methylidene]benzohydrazide
4-methoxy-N'-[(3-nitrophenyl)methylidene]benzohydrazide
Compound characteristics
| Compound ID: | 1218-2049 |
| Compound Name: | 4-methoxy-N'-[(3-nitrophenyl)methylidene]benzohydrazide |
| Molecular Weight: | 299.28 |
| Molecular Formula: | C15 H13 N3 O4 |
| Smiles: | COc1ccc(cc1)C(N/N=C/c1cccc(c1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.922 |
| logD: | 2.9157 |
| logSw: | -3.4512 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.479 |
| InChI Key: | HSROVYYCGBKLEL-UHFFFAOYSA-N |