2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-ethoxyphenyl)prop-2-enenitrile
Chemical Structure Depiction of
2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-ethoxyphenyl)prop-2-enenitrile
2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-ethoxyphenyl)prop-2-enenitrile
Compound characteristics
| Compound ID: | 1246-0626 |
| Compound Name: | 2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-ethoxyphenyl)prop-2-enenitrile |
| Molecular Weight: | 360.48 |
| Molecular Formula: | C22 H20 N2 O S |
| Smiles: | CCOc1ccccc1\C=C(/C#N)c1nc(cs1)c1ccc(C)cc1C |
| Stereo: | ACHIRAL |
| logP: | 6.5406 |
| logD: | 6.5406 |
| logSw: | -5.8398 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 33.967 |
| InChI Key: | VOQOCOKWILVQRD-UHFFFAOYSA-N |